C29H25Cl2NO9 — CID 70183933
cis-(1R,3S)-4-[[(2S,3R)-4-(3,4-dichlorophenyl)-3-(naphthalene-2-carbonyloxy)butan-2-yl]carbamoyl]cyclobutane-1,2,3-tricarboxylic acid (PubChem CID 70183933) has the molecular formula C29H25Cl2NO9 and a molecular weight of 602.42 g/mol. Its IUPAC name is cis-(1R,3S)-4-[[(2S,3R)-4-(3,4-dichlorophenyl)-3-(naphthalene-2-carbonyloxy)butan-2-yl]carbamoyl]cyclobutane-1,2,3-tricarboxylic acid.
| Compound Name | cis-(1R,3S)-4-[[(2S,3R)-4-(3,4-dichlorophenyl)-3-(naphthalene-2-carbonyloxy)butan-2-yl]carbamoyl]cyclobutane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 70183933 |
| Molecular Formula | C29H25Cl2NO9 |
| Molecular Weight | 602.42 g/mol |
| Exact Mass | 601.09 |
| IUPAC Name | cis-(1R,3S)-4-[[(2S,3R)-4-(3,4-dichlorophenyl)-3-(naphthalene-2-carbonyloxy)butan-2-yl]carbamoyl]cyclobutane-1,2,3-tricarboxylic acid |
| SMILES | C[C@H](NC(=O)C1[C@H](C(=O)O)C(C(=O)O)[C@@H]1C(=O)O)[C@@H](Cc1ccc(Cl)c(Cl)c1)OC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C29H25Cl2NO9/c1-13(32-25(33)21-22(26(34)35)24(28(38)39)23(21)27(36)37)20(11-14-6-9-18(30)19(31)10-14)41-29(40)17-8-7-15-4-2-3-5-16(15)12-17/h2-10,12-13,20-24H,11H2,1H3,(H,32,33)(H,34,35)(H,36,37)(H,38,39)/t13-,20+,21?,22-,23+,24?/m0/s1 |
| InChIKey | HDYAKSTYRUTHJA-OPWRNZRSSA-N |
| XLogP | 4.15 |
| TPSA | 167.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.42 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |