C30H48N2O5 — CID 70184505
1-butyl-3-[(10Z)-3,4-dihydroxy-7,11,14-trimethyl-2-methylidene-5-oxo-17-propan-2-yl-6-oxatetracyclo[10.7.0.03,8.014,18]nonadec-10-en-16-yl]urea (PubChem CID 70184505) has the molecular formula C30H48N2O5 and a molecular weight of 516.72 g/mol. Its IUPAC name is 1-butyl-3-[(10Z)-3,4-dihydroxy-7,11,14-trimethyl-2-methylidene-5-oxo-17-propan-2-yl-6-oxatetracyclo[10.7.0.03,8.014,18]nonadec-10-en-16-yl]urea.
| Compound Name | 1-butyl-3-[(10Z)-3,4-dihydroxy-7,11,14-trimethyl-2-methylidene-5-oxo-17-propan-2-yl-6-oxatetracyclo[10.7.0.03,8.014,18]nonadec-10-en-16-yl]urea |
|---|---|
| PubChem CID | 70184505 |
| Molecular Formula | C30H48N2O5 |
| Molecular Weight | 516.72 g/mol |
| Exact Mass | 516.36 |
| IUPAC Name | 1-butyl-3-[(10Z)-3,4-dihydroxy-7,11,14-trimethyl-2-methylidene-5-oxo-17-propan-2-yl-6-oxatetracyclo[10.7.0.03,8.014,18]nonadec-10-en-16-yl]urea |
| SMILES | C=C1C2CC3C(C(C)C)C(NC(=O)NCCCC)CC3(C)CC2/C(C)=C\CC2C(C)OC(=O)C(O)C12O |
| InChI | InChI=1S/C30H48N2O5/c1-8-9-12-31-28(35)32-24-15-29(7)14-21-17(4)10-11-22-19(6)37-27(34)26(33)30(22,36)18(5)20(21)13-23(29)25(24)16(2)3/h10,16,19-26,33,36H,5,8-9,11-15H2,1-4,6-7H3,(H2,31,32,35)/b17-10- |
| InChIKey | ZAHWTGHLLJISSB-YVLHZVERSA-N |
| XLogP | 4.34 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.72 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|