C14H30N4O2 — CID 138741560
1-[(3R,6R)-5-amino-6-(aminomethyl)-2-methyloxan-3-yl]-3-hexylurea (PubChem CID 138741560) has the molecular formula C14H30N4O2 and a molecular weight of 286.42 g/mol. Its IUPAC name is 1-[(3R,6R)-5-amino-6-(aminomethyl)-2-methyloxan-3-yl]-3-hexylurea.
| Compound Name | 1-[(3R,6R)-5-amino-6-(aminomethyl)-2-methyloxan-3-yl]-3-hexylurea |
|---|---|
| PubChem CID | 138741560 |
| Molecular Formula | C14H30N4O2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | 1-[(3R,6R)-5-amino-6-(aminomethyl)-2-methyloxan-3-yl]-3-hexylurea |
| SMILES | CCCCCCNC(=O)N[C@@H]1CC(N)[C@@H](CN)OC1C |
| InChI | InChI=1S/C14H30N4O2/c1-3-4-5-6-7-17-14(19)18-12-8-11(16)13(9-15)20-10(12)2/h10-13H,3-9,15-16H2,1-2H3,(H2,17,18,19)/t10?,11?,12-,13-/m1/s1 |
| InChIKey | HFPIDFJGTHFIPK-FIYWTHMPSA-N |
| XLogP | 0.70 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|