C26H38O4 — CID 70187711
8-[2-[[3,4-bis(hydroxymethyl)phenyl]methoxy]phenyl]-3-ethylnonan-3-ol (PubChem CID 70187711) has the molecular formula C26H38O4 and a molecular weight of 414.59 g/mol. Its IUPAC name is 8-[2-[[3,4-bis(hydroxymethyl)phenyl]methoxy]phenyl]-3-ethylnonan-3-ol.
| Compound Name | 8-[2-[[3,4-bis(hydroxymethyl)phenyl]methoxy]phenyl]-3-ethylnonan-3-ol |
|---|---|
| PubChem CID | 70187711 |
| Molecular Formula | C26H38O4 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | 8-[2-[[3,4-bis(hydroxymethyl)phenyl]methoxy]phenyl]-3-ethylnonan-3-ol |
| SMILES | CCC(O)(CC)CCCCC(C)c1ccccc1OCc1ccc(CO)c(CO)c1 |
| InChI | InChI=1S/C26H38O4/c1-4-26(29,5-2)15-9-8-10-20(3)24-11-6-7-12-25(24)30-19-21-13-14-22(17-27)23(16-21)18-28/h6-7,11-14,16,20,27-29H,4-5,8-10,15,17-19H2,1-3H3 |
| InChIKey | NQPSDMNGBWVQLK-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|