About bis(azepine-1-carboxamide);hydrate
bis(azepine-1-carboxamide);hydrate (PubChem CID 70193934) has the molecular formula C14H18N4O3
and a molecular weight of 290.32 g/mol. Its IUPAC name is bis(azepine-1-carboxamide);hydrate.
Molecular Properties
| Compound Name | bis(azepine-1-carboxamide);hydrate |
| PubChem CID | 70193934 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | bis(azepine-1-carboxamide);hydrate |
| SMILES | NC(=O)N1C=CC=CC=C1.NC(=O)N1C=CC=CC=C1.O |
| InChI | InChI=1S/2C7H8N2O.H2O/c2*8-7(10)9-5-3-1-2-4-6-9;/h2*1-6H,(H2,8,10);1H2 |
| InChIKey | VFLFRSYFZSOFAB-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 124.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bis(azepine-1-carboxamide);hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(azepine-1-carboxamide);hydrate?
The IUPAC name of bis(azepine-1-carboxamide);hydrate (CID 70193934) is bis(azepine-1-carboxamide);hydrate.
What is the SMILES notation for bis(azepine-1-carboxamide);hydrate?
The canonical SMILES for bis(azepine-1-carboxamide);hydrate is NC(=O)N1C=CC=CC=C1.NC(=O)N1C=CC=CC=C1.O.
What is the InChIKey of bis(azepine-1-carboxamide);hydrate?
The InChIKey is VFLFRSYFZSOFAB-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H8N2O.H2O/c2*8-7(10)9-5-3-1-2-4-6-9;/h2*1-6H,(H2,8,10);1H2.
What are the key properties of bis(azepine-1-carboxamide);hydrate?
bis(azepine-1-carboxamide);hydrate has a molecular weight of 290.32 g/mol, XLogP of 1.10, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(azepine-1-carboxamide);hydrate is sourced from PubChem (CID 70193934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).