About azepine-1-carboxamide
azepine-1-carboxamide (PubChem CID 21247429) has the molecular formula C7H8N2O
and a molecular weight of 136.15 g/mol. Its IUPAC name is azepine-1-carboxamide.
Molecular Properties
| Compound Name | azepine-1-carboxamide |
| PubChem CID | 21247429 |
| Molecular Formula | C7H8N2O |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.06 |
| IUPAC Name | azepine-1-carboxamide |
| SMILES | NC(=O)N1C=CC=CC=C1 |
| InChI | InChI=1S/C7H8N2O/c8-7(10)9-5-3-1-2-4-6-9/h1-6H,(H2,8,10) |
| InChIKey | WYVODKWLXXDREA-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze azepine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azepine-1-carboxamide?
The IUPAC name of azepine-1-carboxamide (CID 21247429) is azepine-1-carboxamide.
What is the SMILES notation for azepine-1-carboxamide?
The canonical SMILES for azepine-1-carboxamide is NC(=O)N1C=CC=CC=C1.
What is the InChIKey of azepine-1-carboxamide?
The InChIKey is WYVODKWLXXDREA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O/c8-7(10)9-5-3-1-2-4-6-9/h1-6H,(H2,8,10).
What are the key properties of azepine-1-carboxamide?
azepine-1-carboxamide has a molecular weight of 136.15 g/mol, XLogP of 0.96, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azepine-1-carboxamide is sourced from PubChem (CID 21247429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).