C6H8N2O — CID 67472845
3-methyl-1H-1,3-diazepin-2-one (PubChem CID 67472845) has the molecular formula C6H8N2O and a molecular weight of 124.14 g/mol. Its IUPAC name is 3-methyl-1H-1,3-diazepin-2-one.
| Compound Name | 3-methyl-1H-1,3-diazepin-2-one |
|---|---|
| PubChem CID | 67472845 |
| Molecular Formula | C6H8N2O |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.06 |
| IUPAC Name | 3-methyl-1H-1,3-diazepin-2-one |
| SMILES | CN1C=CC=CNC1=O |
| InChI | InChI=1S/C6H8N2O/c1-8-5-3-2-4-7-6(8)9/h2-5H,1H3,(H,7,9) |
| InChIKey | FMVMWRAJBYIPFO-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |