C6H10N2O — CID 143534959
1-[(1Z)-buta-1,3-dienyl]-1-methylurea (PubChem CID 143534959) has the molecular formula C6H10N2O and a molecular weight of 126.16 g/mol. Its IUPAC name is 1-[(1Z)-buta-1,3-dienyl]-1-methylurea.
| Compound Name | 1-[(1Z)-buta-1,3-dienyl]-1-methylurea |
|---|---|
| PubChem CID | 143534959 |
| Molecular Formula | C6H10N2O |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | 1-[(1Z)-buta-1,3-dienyl]-1-methylurea |
| SMILES | C=C/C=C\N(C)C(N)=O |
| InChI | InChI=1S/C6H10N2O/c1-3-4-5-8(2)6(7)9/h3-5H,1H2,2H3,(H2,7,9)/b5-4- |
| InChIKey | ILYMDBQBWDZOIS-PLNGDYQASA-N |
| XLogP | 0.70 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|