C20H23ClFN3O — CID 70195927
1-(3-chlorophenyl)-3-[5-[(4-fluorophenyl)methyl]piperidin-2-yl]-1-methylurea (PubChem CID 70195927) has the molecular formula C20H23ClFN3O and a molecular weight of 375.88 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[5-[(4-fluorophenyl)methyl]piperidin-2-yl]-1-methylurea.
| Compound Name | 1-(3-chlorophenyl)-3-[5-[(4-fluorophenyl)methyl]piperidin-2-yl]-1-methylurea |
|---|---|
| PubChem CID | 70195927 |
| Molecular Formula | C20H23ClFN3O |
| Molecular Weight | 375.88 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[5-[(4-fluorophenyl)methyl]piperidin-2-yl]-1-methylurea |
| SMILES | CN(C(=O)NC1CCC(Cc2ccc(F)cc2)CN1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H23ClFN3O/c1-25(18-4-2-3-16(21)12-18)20(26)24-19-10-7-15(13-23-19)11-14-5-8-17(22)9-6-14/h2-6,8-9,12,15,19,23H,7,10-11,13H2,1H3,(H,24,26) |
| InChIKey | GWELJAHSGJWBKJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.88 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |