C19H24ClN5O — CID 155153161
N-[5-[(3-chlorophenyl)methyl]piperidin-2-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-7-carboxamide (PubChem CID 155153161) has the molecular formula C19H24ClN5O and a molecular weight of 373.89 g/mol. Its IUPAC name is N-[5-[(3-chlorophenyl)methyl]piperidin-2-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-7-carboxamide.
| Compound Name | N-[5-[(3-chlorophenyl)methyl]piperidin-2-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 155153161 |
| Molecular Formula | C19H24ClN5O |
| Molecular Weight | 373.89 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | N-[5-[(3-chlorophenyl)methyl]piperidin-2-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-7-carboxamide |
| SMILES | O=C(NC1CCC(Cc2cccc(Cl)c2)CN1)C1CCn2cnnc2C1 |
| InChI | InChI=1S/C19H24ClN5O/c20-16-3-1-2-13(9-16)8-14-4-5-17(21-11-14)23-19(26)15-6-7-25-12-22-24-18(25)10-15/h1-3,9,12,14-15,17,21H,4-8,10-11H2,(H,23,26) |
| InChIKey | RLNHLSRZKLAKOM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.89 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |