C19H23N3O6 — CID 70195986
but-2-enedioic acid;4-[[3-[2-(methylamino)ethyl]-1H-indol-5-yl]methyl]-1,3-oxazolidin-2-one (PubChem CID 70195986) has the molecular formula C19H23N3O6 and a molecular weight of 389.41 g/mol. Its IUPAC name is but-2-enedioic acid;4-[[3-[2-(methylamino)ethyl]-1H-indol-5-yl]methyl]-1,3-oxazolidin-2-one.
| Compound Name | but-2-enedioic acid;4-[[3-[2-(methylamino)ethyl]-1H-indol-5-yl]methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 70195986 |
| Molecular Formula | C19H23N3O6 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | but-2-enedioic acid;4-[[3-[2-(methylamino)ethyl]-1H-indol-5-yl]methyl]-1,3-oxazolidin-2-one |
| SMILES | CNCCc1c[nH]c2ccc(CC3COC(=O)N3)cc12.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C15H19N3O2.C4H4O4/c1-16-5-4-11-8-17-14-3-2-10(7-13(11)14)6-12-9-20-15(19)18-12;5-3(6)1-2-4(7)8/h2-3,7-8,12,16-17H,4-6,9H2,1H3,(H,18,19);1-2H,(H,5,6)(H,7,8) |
| InChIKey | QDOIJUTVHIQKFS-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 140.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|