C16H19N3O2 — CID 18691541
4-[[3-(3-aminocyclobutyl)-1H-indol-5-yl]methyl]-1,3-oxazolidin-2-one (PubChem CID 18691541) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 4-[[3-(3-aminocyclobutyl)-1H-indol-5-yl]methyl]-1,3-oxazolidin-2-one.
| Compound Name | 4-[[3-(3-aminocyclobutyl)-1H-indol-5-yl]methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 18691541 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 4-[[3-(3-aminocyclobutyl)-1H-indol-5-yl]methyl]-1,3-oxazolidin-2-one |
| SMILES | NC1CC(c2c[nH]c3ccc(CC4COC(=O)N4)cc23)C1 |
| InChI | InChI=1S/C16H19N3O2/c17-11-5-10(6-11)14-7-18-15-2-1-9(4-13(14)15)3-12-8-21-16(20)19-12/h1-2,4,7,10-12,18H,3,5-6,8,17H2,(H,19,20) |
| InChIKey | ITXICYVPEAFHQO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 80.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |