C10H11IN2O2 — CID 19358405
4-[(4-amino-3-iodophenyl)methyl]-1,3-oxazolidin-2-one (PubChem CID 19358405) has the molecular formula C10H11IN2O2 and a molecular weight of 318.11 g/mol. Its IUPAC name is 4-[(4-amino-3-iodophenyl)methyl]-1,3-oxazolidin-2-one.
| Compound Name | 4-[(4-amino-3-iodophenyl)methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 19358405 |
| Molecular Formula | C10H11IN2O2 |
| Molecular Weight | 318.11 g/mol |
| Exact Mass | 317.99 |
| IUPAC Name | 4-[(4-amino-3-iodophenyl)methyl]-1,3-oxazolidin-2-one |
| SMILES | Nc1ccc(CC2COC(=O)N2)cc1I |
| InChI | InChI=1S/C10H11IN2O2/c11-8-4-6(1-2-9(8)12)3-7-5-15-10(14)13-7/h1-2,4,7H,3,5,12H2,(H,13,14) |
| InChIKey | SJVUXDATXXXNQY-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.11 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|