C17H18ClN3O — CID 70196692
[3-[5-(4-methoxyphenyl)-1H-imidazol-2-yl]phenyl]methanamine;hydrochloride (PubChem CID 70196692) has the molecular formula C17H18ClN3O and a molecular weight of 315.80 g/mol. Its IUPAC name is [3-[5-(4-methoxyphenyl)-1H-imidazol-2-yl]phenyl]methanamine;hydrochloride.
| Compound Name | [3-[5-(4-methoxyphenyl)-1H-imidazol-2-yl]phenyl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 70196692 |
| Molecular Formula | C17H18ClN3O |
| Molecular Weight | 315.80 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | [3-[5-(4-methoxyphenyl)-1H-imidazol-2-yl]phenyl]methanamine;hydrochloride |
| SMILES | COc1ccc(-c2cnc(-c3cccc(CN)c3)[nH]2)cc1.Cl |
| InChI | InChI=1S/C17H17N3O.ClH/c1-21-15-7-5-13(6-8-15)16-11-19-17(20-16)14-4-2-3-12(9-14)10-18;/h2-9,11H,10,18H2,1H3,(H,19,20);1H |
| InChIKey | LZLQQTUMOPCCIS-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.80 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |