C25H27N3O4 — CID 70196744
benzyl N-[(2S)-3-hydroxy-1-[[2-(3-pyridin-2-ylphenyl)acetyl]amino]butan-2-yl]carbamate (PubChem CID 70196744) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is benzyl N-[(2S)-3-hydroxy-1-[[2-(3-pyridin-2-ylphenyl)acetyl]amino]butan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-3-hydroxy-1-[[2-(3-pyridin-2-ylphenyl)acetyl]amino]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 70196744 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | benzyl N-[(2S)-3-hydroxy-1-[[2-(3-pyridin-2-ylphenyl)acetyl]amino]butan-2-yl]carbamate |
| SMILES | CC(O)[C@H](CNC(=O)Cc1cccc(-c2ccccn2)c1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H27N3O4/c1-18(29)23(28-25(31)32-17-19-8-3-2-4-9-19)16-27-24(30)15-20-10-7-11-21(14-20)22-12-5-6-13-26-22/h2-14,18,23,29H,15-17H2,1H3,(H,27,30)(H,28,31)/t18?,23-/m0/s1 |
| InChIKey | JDWWNDOTPFVOIH-IMMUGOHXSA-N |
| XLogP | 3.08 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |