C16H21N3O2 — CID 18934604
benzyl N-[1-(1H-imidazol-2-yl)-3-methylbutan-2-yl]carbamate (PubChem CID 18934604) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is benzyl N-[1-(1H-imidazol-2-yl)-3-methylbutan-2-yl]carbamate.
| Compound Name | benzyl N-[1-(1H-imidazol-2-yl)-3-methylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18934604 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | benzyl N-[1-(1H-imidazol-2-yl)-3-methylbutan-2-yl]carbamate |
| SMILES | CC(C)C(Cc1ncc[nH]1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H21N3O2/c1-12(2)14(10-15-17-8-9-18-15)19-16(20)21-11-13-6-4-3-5-7-13/h3-9,12,14H,10-11H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | RDRNZDUOCLRIAX-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |