C8H14N2 — CID 70197606
(6,6-dimethylcyclohexa-2,4-dien-1-yl)hydrazine (PubChem CID 70197606) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is (6,6-dimethylcyclohexa-2,4-dien-1-yl)hydrazine.
| Compound Name | (6,6-dimethylcyclohexa-2,4-dien-1-yl)hydrazine |
|---|---|
| PubChem CID | 70197606 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | (6,6-dimethylcyclohexa-2,4-dien-1-yl)hydrazine |
| SMILES | CC1(C)C=CC=CC1NN |
| InChI | InChI=1S/C8H14N2/c1-8(2)6-4-3-5-7(8)10-9/h3-7,10H,9H2,1-2H3 |
| InChIKey | CVSCVWSLLOINHX-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|