C19H19ClFNO9 — CID 70198831
2-acetamidobutanoic acid;but-2-ynedioic acid;3-(2-chloro-4-fluorophenyl)prop-2-enoic acid (PubChem CID 70198831) has the molecular formula C19H19ClFNO9 and a molecular weight of 459.81 g/mol. Its IUPAC name is 2-acetamidobutanoic acid;but-2-ynedioic acid;3-(2-chloro-4-fluorophenyl)prop-2-enoic acid.
| Compound Name | 2-acetamidobutanoic acid;but-2-ynedioic acid;3-(2-chloro-4-fluorophenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 70198831 |
| Molecular Formula | C19H19ClFNO9 |
| Molecular Weight | 459.81 g/mol |
| Exact Mass | 459.07 |
| IUPAC Name | 2-acetamidobutanoic acid;but-2-ynedioic acid;3-(2-chloro-4-fluorophenyl)prop-2-enoic acid |
| SMILES | CCC(NC(C)=O)C(=O)O.O=C(O)C#CC(=O)O.O=C(O)C=Cc1ccc(F)cc1Cl |
| InChI | InChI=1S/C9H6ClFO2.C6H11NO3.C4H2O4/c10-8-5-7(11)3-1-6(8)2-4-9(12)13;1-3-5(6(9)10)7-4(2)8;5-3(6)1-2-4(7)8/h1-5H,(H,12,13);5H,3H2,1-2H3,(H,7,8)(H,9,10);(H,5,6)(H,7,8) |
| InChIKey | IPVDLVDJECIBIK-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 178.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.81 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|