C22H26FN3O2 — CID 70199036
(3S)-3-[[1-amino-4-(2-fluorophenyl)butan-2-yl]amino]-4-(1H-indol-3-yl)butanoic acid (PubChem CID 70199036) has the molecular formula C22H26FN3O2 and a molecular weight of 383.47 g/mol. Its IUPAC name is (3S)-3-[[1-amino-4-(2-fluorophenyl)butan-2-yl]amino]-4-(1H-indol-3-yl)butanoic acid.
| Compound Name | (3S)-3-[[1-amino-4-(2-fluorophenyl)butan-2-yl]amino]-4-(1H-indol-3-yl)butanoic acid |
|---|---|
| PubChem CID | 70199036 |
| Molecular Formula | C22H26FN3O2 |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | (3S)-3-[[1-amino-4-(2-fluorophenyl)butan-2-yl]amino]-4-(1H-indol-3-yl)butanoic acid |
| SMILES | NCC(CCc1ccccc1F)N[C@H](CC(=O)O)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C22H26FN3O2/c23-20-7-3-1-5-15(20)9-10-17(13-24)26-18(12-22(27)28)11-16-14-25-21-8-4-2-6-19(16)21/h1-8,14,17-18,25-26H,9-13,24H2,(H,27,28)/t17?,18-/m0/s1 |
| InChIKey | POJQBIUOXJBGFR-ZVAWYAOSSA-N |
| XLogP | 3.24 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |