C23H29N3O3 — CID 70202914
(3S)-3-[[1-amino-4-(4-methoxyphenyl)butan-2-yl]amino]-4-(1H-indol-3-yl)butanoic acid (PubChem CID 70202914) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is (3S)-3-[[1-amino-4-(4-methoxyphenyl)butan-2-yl]amino]-4-(1H-indol-3-yl)butanoic acid.
| Compound Name | (3S)-3-[[1-amino-4-(4-methoxyphenyl)butan-2-yl]amino]-4-(1H-indol-3-yl)butanoic acid |
|---|---|
| PubChem CID | 70202914 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | (3S)-3-[[1-amino-4-(4-methoxyphenyl)butan-2-yl]amino]-4-(1H-indol-3-yl)butanoic acid |
| SMILES | COc1ccc(CCC(CN)N[C@H](CC(=O)O)Cc2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C23H29N3O3/c1-29-20-10-7-16(8-11-20)6-9-18(14-24)26-19(13-23(27)28)12-17-15-25-22-5-3-2-4-21(17)22/h2-5,7-8,10-11,15,18-19,25-26H,6,9,12-14,24H2,1H3,(H,27,28)/t18?,19-/m0/s1 |
| InChIKey | BXKHPBKUIVKHRT-GGYWPGCISA-N |
| XLogP | 3.11 |
| TPSA | 100.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |