C9H16N4O5 — CID 7020055
2-[[(2S)-5-amino-2-[(2-aminoacetyl)amino]-5-oxopentanoyl]amino]acetic acid (PubChem CID 7020055) has the molecular formula C9H16N4O5 and a molecular weight of 260.25 g/mol. Its IUPAC name is 2-[[(2S)-5-amino-2-[(2-aminoacetyl)amino]-5-oxopentanoyl]amino]acetic acid.
| Compound Name | 2-[[(2S)-5-amino-2-[(2-aminoacetyl)amino]-5-oxopentanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 7020055 |
| Molecular Formula | C9H16N4O5 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 2-[[(2S)-5-amino-2-[(2-aminoacetyl)amino]-5-oxopentanoyl]amino]acetic acid |
| SMILES | NCC(=O)N[C@@H](CCC(N)=O)C(=O)NCC(=O)O |
| InChI | InChI=1S/C9H16N4O5/c10-3-7(15)13-5(1-2-6(11)14)9(18)12-4-8(16)17/h5H,1-4,10H2,(H2,11,14)(H,12,18)(H,13,15)(H,16,17)/t5-/m0/s1 |
| InChIKey | BYYNJRSNDARRBX-YFKPBYRVSA-N |
| XLogP | -3.10 |
| TPSA | 164.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | -3.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |