C28H31N7O2 — CID 70202034
5-[(E)-but-2-enyl]-2-(2-cyclohexylacetyl)-4-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazol-3-one (PubChem CID 70202034) has the molecular formula C28H31N7O2 and a molecular weight of 497.60 g/mol. Its IUPAC name is 5-[(E)-but-2-enyl]-2-(2-cyclohexylacetyl)-4-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazol-3-one.
| Compound Name | 5-[(E)-but-2-enyl]-2-(2-cyclohexylacetyl)-4-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 70202034 |
| Molecular Formula | C28H31N7O2 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.25 |
| IUPAC Name | 5-[(E)-but-2-enyl]-2-(2-cyclohexylacetyl)-4-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazol-3-one |
| SMILES | C/C=C/Cc1nn(C(=O)CC2CCCCC2)c(=O)n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C28H31N7O2/c1-2-3-13-25-31-35(26(36)18-20-9-5-4-6-10-20)28(37)34(25)19-21-14-16-22(17-15-21)23-11-7-8-12-24(23)27-29-32-33-30-27/h2-3,7-8,11-12,14-17,20H,4-6,9-10,13,18-19H2,1H3,(H,29,30,32,33)/b3-2+ |
| InChIKey | ISACOUDQCDSDCC-NSCUHMNNSA-N |
| XLogP | 4.67 |
| TPSA | 111.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|