C32H41N3O4 — CID 91602828
2-[4-[[1-(2-cyclohexylacetyl)-3-octyl-5-oxo-1,2,4-triazol-4-yl]methyl]phenyl]benzoic acid (PubChem CID 91602828) has the molecular formula C32H41N3O4 and a molecular weight of 531.70 g/mol. Its IUPAC name is 2-[4-[[1-(2-cyclohexylacetyl)-3-octyl-5-oxo-1,2,4-triazol-4-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[1-(2-cyclohexylacetyl)-3-octyl-5-oxo-1,2,4-triazol-4-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 91602828 |
| Molecular Formula | C32H41N3O4 |
| Molecular Weight | 531.70 g/mol |
| Exact Mass | 531.31 |
| IUPAC Name | 2-[4-[[1-(2-cyclohexylacetyl)-3-octyl-5-oxo-1,2,4-triazol-4-yl]methyl]phenyl]benzoic acid |
| SMILES | CCCCCCCCc1nn(C(=O)CC2CCCCC2)c(=O)n1Cc1ccc(-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C32H41N3O4/c1-2-3-4-5-6-10-17-29-33-35(30(36)22-24-13-8-7-9-14-24)32(39)34(29)23-25-18-20-26(21-19-25)27-15-11-12-16-28(27)31(37)38/h11-12,15-16,18-21,24H,2-10,13-14,17,22-23H2,1H3,(H,37,38) |
| InChIKey | NMRVXOCJTAZHDK-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.70 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|