C12H18ClNO2 — CID 70203026
3-methyl-3-(methylamino)-2-phenylbutanoic acid;hydrochloride (PubChem CID 70203026) has the molecular formula C12H18ClNO2 and a molecular weight of 243.73 g/mol. Its IUPAC name is 3-methyl-3-(methylamino)-2-phenylbutanoic acid;hydrochloride.
| Compound Name | 3-methyl-3-(methylamino)-2-phenylbutanoic acid;hydrochloride |
|---|---|
| PubChem CID | 70203026 |
| Molecular Formula | C12H18ClNO2 |
| Molecular Weight | 243.73 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 3-methyl-3-(methylamino)-2-phenylbutanoic acid;hydrochloride |
| SMILES | CNC(C)(C)C(C(=O)O)c1ccccc1.Cl |
| InChI | InChI=1S/C12H17NO2.ClH/c1-12(2,13-3)10(11(14)15)9-7-5-4-6-8-9;/h4-8,10,13H,1-3H3,(H,14,15);1H |
| InChIKey | CIJCSSXFVPDORL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.73 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |