C22H34N2O6S — CID 70204746
4-ethoxycarbonyl-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-[[3-[1-(sulfinoamino)ethyl]phenyl]methyl]piperidine (PubChem CID 70204746) has the molecular formula C22H34N2O6S and a molecular weight of 454.59 g/mol. Its IUPAC name is 4-ethoxycarbonyl-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-[[3-[1-(sulfinoamino)ethyl]phenyl]methyl]piperidine.
| Compound Name | 4-ethoxycarbonyl-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-[[3-[1-(sulfinoamino)ethyl]phenyl]methyl]piperidine |
|---|---|
| PubChem CID | 70204746 |
| Molecular Formula | C22H34N2O6S |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | 4-ethoxycarbonyl-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-[[3-[1-(sulfinoamino)ethyl]phenyl]methyl]piperidine |
| SMILES | CCOC(=O)C1(Cc2cccc(C(C)NS(=O)O)c2)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C22H34N2O6S/c1-6-29-19(25)22(10-12-24(13-11-22)20(26)30-21(3,4)5)15-17-8-7-9-18(14-17)16(2)23-31(27)28/h7-9,14,16,23H,6,10-13,15H2,1-5H3,(H,27,28) |
| InChIKey | TXMWZTYOAUAILS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|