C7H4Br2NO2- — CID 7020620
2-amino-4,5-dibromobenzoate (PubChem CID 7020620) has the molecular formula C7H4Br2NO2- and a molecular weight of 293.92 g/mol. Its IUPAC name is 2-amino-4,5-dibromobenzoate.
| Compound Name | 2-amino-4,5-dibromobenzoate |
|---|---|
| PubChem CID | 7020620 |
| Molecular Formula | C7H4Br2NO2- |
| Molecular Weight | 293.92 g/mol |
| Exact Mass | 291.86 |
| IUPAC Name | 2-amino-4,5-dibromobenzoate |
| SMILES | Nc1cc(Br)c(Br)cc1C(=O)[O-] |
| InChI | InChI=1S/C7H5Br2NO2/c8-4-1-3(7(11)12)6(10)2-5(4)9/h1-2H,10H2,(H,11,12)/p-1 |
| InChIKey | RJQGTUPMSDNELX-UHFFFAOYSA-M |
| XLogP | 1.16 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.92 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|