About 2-amino-5-iodobenzoate
2-amino-5-iodobenzoate (PubChem CID 6919461) has the molecular formula C7H5INO2-
and a molecular weight of 262.03 g/mol. Its IUPAC name is 2-amino-5-iodobenzoate.
Molecular Properties
| Compound Name | 2-amino-5-iodobenzoate |
| PubChem CID | 6919461 |
| Molecular Formula | C7H5INO2- |
| Molecular Weight | 262.03 g/mol |
| Exact Mass | 261.94 |
| IUPAC Name | 2-amino-5-iodobenzoate |
| SMILES | Nc1ccc(I)cc1C(=O)[O-] |
| InChI | InChI=1S/C7H6INO2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,9H2,(H,10,11)/p-1 |
| InChIKey | GOLGILSVWFKZRQ-UHFFFAOYSA-M |
| XLogP | 0.24 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.03 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-5-iodobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-iodobenzoate?
The IUPAC name of 2-amino-5-iodobenzoate (CID 6919461) is 2-amino-5-iodobenzoate.
What is the SMILES notation for 2-amino-5-iodobenzoate?
The canonical SMILES for 2-amino-5-iodobenzoate is Nc1ccc(I)cc1C(=O)[O-].
What is the InChIKey of 2-amino-5-iodobenzoate?
The InChIKey is GOLGILSVWFKZRQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H6INO2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,9H2,(H,10,11)/p-1.
What are the key properties of 2-amino-5-iodobenzoate?
2-amino-5-iodobenzoate has a molecular weight of 262.03 g/mol, XLogP of 0.24, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-iodobenzoate is sourced from PubChem (CID 6919461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).