C13H14ClN3O3 — CID 70209075
[3-(4-carbamimidoylphenyl)-1,2-oxazol-5-yl] propanoate;hydrochloride (PubChem CID 70209075) has the molecular formula C13H14ClN3O3 and a molecular weight of 295.73 g/mol. Its IUPAC name is [3-(4-carbamimidoylphenyl)-1,2-oxazol-5-yl] propanoate;hydrochloride.
| Compound Name | [3-(4-carbamimidoylphenyl)-1,2-oxazol-5-yl] propanoate;hydrochloride |
|---|---|
| PubChem CID | 70209075 |
| Molecular Formula | C13H14ClN3O3 |
| Molecular Weight | 295.73 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | [3-(4-carbamimidoylphenyl)-1,2-oxazol-5-yl] propanoate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(-c2cc(OC(=O)CC)on2)cc1 |
| InChI | InChI=1S/C13H13N3O3.ClH/c1-2-11(17)18-12-7-10(16-19-12)8-3-5-9(6-4-8)13(14)15;/h3-7H,2H2,1H3,(H3,14,15);1H |
| InChIKey | XRYQJHBRGBQXCC-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.73 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|