C21H23NO5 — CID 70209233
prop-2-enyl 4-[5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-6-oxo-1H-pyridin-3-yl]benzoate (PubChem CID 70209233) has the molecular formula C21H23NO5 and a molecular weight of 369.42 g/mol. Its IUPAC name is prop-2-enyl 4-[5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-6-oxo-1H-pyridin-3-yl]benzoate.
| Compound Name | prop-2-enyl 4-[5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-6-oxo-1H-pyridin-3-yl]benzoate |
|---|---|
| PubChem CID | 70209233 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | prop-2-enyl 4-[5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-6-oxo-1H-pyridin-3-yl]benzoate |
| SMILES | C=CCOC(=O)c1ccc(-c2c[nH]c(=O)c(CC(=O)OC(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C21H23NO5/c1-5-10-26-20(25)15-8-6-14(7-9-15)17-11-16(19(24)22-13-17)12-18(23)27-21(2,3)4/h5-9,11,13H,1,10,12H2,2-4H3,(H,22,24) |
| InChIKey | KWCWUBISFLSLLR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|