C25H31N3O2 — CID 70209457
(4S)-4,7-diamino-1-naphthalen-2-yloxy-2-(2-phenylethylamino)heptan-3-one (PubChem CID 70209457) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is (4S)-4,7-diamino-1-naphthalen-2-yloxy-2-(2-phenylethylamino)heptan-3-one.
| Compound Name | (4S)-4,7-diamino-1-naphthalen-2-yloxy-2-(2-phenylethylamino)heptan-3-one |
|---|---|
| PubChem CID | 70209457 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | (4S)-4,7-diamino-1-naphthalen-2-yloxy-2-(2-phenylethylamino)heptan-3-one |
| SMILES | NCCC[C@H](N)C(=O)C(COc1ccc2ccccc2c1)NCCc1ccccc1 |
| InChI | InChI=1S/C25H31N3O2/c26-15-6-11-23(27)25(29)24(28-16-14-19-7-2-1-3-8-19)18-30-22-13-12-20-9-4-5-10-21(20)17-22/h1-5,7-10,12-13,17,23-24,28H,6,11,14-16,18,26-27H2/t23-,24?/m0/s1 |
| InChIKey | RASUNWUTACRBJG-UXMRNZNESA-N |
| XLogP | 3.05 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |