C32H26O3S — CID 70209700
2-benzyl-3-[2-(4-phenyl-3-thiophen-3-ylphenoxy)phenyl]propanoic acid (PubChem CID 70209700) has the molecular formula C32H26O3S and a molecular weight of 490.62 g/mol. Its IUPAC name is 2-benzyl-3-[2-(4-phenyl-3-thiophen-3-ylphenoxy)phenyl]propanoic acid.
| Compound Name | 2-benzyl-3-[2-(4-phenyl-3-thiophen-3-ylphenoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 70209700 |
| Molecular Formula | C32H26O3S |
| Molecular Weight | 490.62 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | 2-benzyl-3-[2-(4-phenyl-3-thiophen-3-ylphenoxy)phenyl]propanoic acid |
| SMILES | O=C(O)C(Cc1ccccc1)Cc1ccccc1Oc1ccc(-c2ccccc2)c(-c2ccsc2)c1 |
| InChI | InChI=1S/C32H26O3S/c33-32(34)27(19-23-9-3-1-4-10-23)20-25-13-7-8-14-31(25)35-28-15-16-29(24-11-5-2-6-12-24)30(21-28)26-17-18-36-22-26/h1-18,21-22,27H,19-20H2,(H,33,34) |
| InChIKey | HWJVJRUNCQLGKX-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.62 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |