C11H17F3N2O3 — CID 7020973
tert-butyl N-[2-[(4,4,4-trifluoro-3-oxobutylidene)amino]ethyl]carbamate (PubChem CID 7020973) has the molecular formula C11H17F3N2O3 and a molecular weight of 282.26 g/mol. Its IUPAC name is tert-butyl N-[2-[(4,4,4-trifluoro-3-oxobutylidene)amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(4,4,4-trifluoro-3-oxobutylidene)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 7020973 |
| Molecular Formula | C11H17F3N2O3 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | tert-butyl N-[2-[(4,4,4-trifluoro-3-oxobutylidene)amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC/N=C/CC(=O)C(F)(F)F |
| InChI | InChI=1S/C11H17F3N2O3/c1-10(2,3)19-9(18)16-7-6-15-5-4-8(17)11(12,13)14/h5H,4,6-7H2,1-3H3,(H,16,18)/b15-5+ |
| InChIKey | YPKPTDVRKOZSJQ-PJQLUOCWSA-N |
| XLogP | 2.10 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|