C34H54N2O — CID 70210533
4-amino-N-[(8S,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-1-yl]benzamide (PubChem CID 70210533) has the molecular formula C34H54N2O and a molecular weight of 506.82 g/mol. Its IUPAC name is 4-amino-N-[(8S,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-1-yl]benzamide.
| Compound Name | 4-amino-N-[(8S,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-1-yl]benzamide |
|---|---|
| PubChem CID | 70210533 |
| Molecular Formula | C34H54N2O |
| Molecular Weight | 506.82 g/mol |
| Exact Mass | 506.42 |
| IUPAC Name | 4-amino-N-[(8S,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-1-yl]benzamide |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CCC4CCCC(NC(=O)c5ccc(N)cc5)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C34H54N2O/c1-22(2)8-6-9-23(3)28-18-19-29-27-17-14-25-10-7-11-31(34(25,5)30(27)20-21-33(28,29)4)36-32(37)24-12-15-26(35)16-13-24/h12-13,15-16,22-23,25,27-31H,6-11,14,17-21,35H2,1-5H3,(H,36,37)/t23-,25?,27+,28-,29+,30+,31?,33-,34+/m1/s1 |
| InChIKey | DBGCXZVRJUHWAT-YKRHZDTKSA-N |
| XLogP | 8.49 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.82 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|