C27H49O4P — CID 56978392
[(8S,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-1-yl] dihydrogen phosphate (PubChem CID 56978392) has the molecular formula C27H49O4P and a molecular weight of 468.66 g/mol. Its IUPAC name is [(8S,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-1-yl] dihydrogen phosphate.
| Compound Name | [(8S,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-1-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 56978392 |
| Molecular Formula | C27H49O4P |
| Molecular Weight | 468.66 g/mol |
| Exact Mass | 468.34 |
| IUPAC Name | [(8S,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-1-yl] dihydrogen phosphate |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CCC4CCCC(OP(=O)(O)O)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H49O4P/c1-18(2)8-6-9-19(3)22-14-15-23-21-13-12-20-10-7-11-25(31-32(28,29)30)27(20,5)24(21)16-17-26(22,23)4/h18-25H,6-17H2,1-5H3,(H2,28,29,30)/t19-,20?,21+,22-,23+,24+,25?,26-,27+/m1/s1 |
| InChIKey | VRMHYNNBMRRHEU-IWYWFISHSA-N |
| XLogP | 7.59 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.66 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|