C34H60O2 — CID 154636508
[(5R,8R,9S,10S,13R,14S,17S)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-1-yl] heptanoate (PubChem CID 154636508) has the molecular formula C34H60O2 and a molecular weight of 500.85 g/mol. Its IUPAC name is [(5R,8R,9S,10S,13R,14S,17S)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-1-yl] heptanoate.
| Compound Name | [(5R,8R,9S,10S,13R,14S,17S)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-1-yl] heptanoate |
|---|---|
| PubChem CID | 154636508 |
| Molecular Formula | C34H60O2 |
| Molecular Weight | 500.85 g/mol |
| Exact Mass | 500.46 |
| IUPAC Name | [(5R,8R,9S,10S,13R,14S,17S)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-1-yl] heptanoate |
| SMILES | CCCCCCC(=O)OC1CCC[C@@H]2CC[C@@H]3[C@@H]4CC[C@@H]([C@@H](C)CCCC(C)C)[C@@]4(C)CC[C@@H]3[C@@]12C |
| InChI | InChI=1S/C34H60O2/c1-7-8-9-10-17-32(35)36-31-16-12-15-26-18-19-27-29-21-20-28(25(4)14-11-13-24(2)3)33(29,5)23-22-30(27)34(26,31)6/h24-31H,7-23H2,1-6H3/t25-,26+,27+,28-,29-,30-,31?,33+,34-/m0/s1 |
| InChIKey | WULXKBDIUWZSSE-OGXMMTHFSA-N |
| XLogP | 9.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.85 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|