C34H50N2O6 — CID 123158374
[(8S,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-1-yl] 3,5-dinitrobenzoate (PubChem CID 123158374) has the molecular formula C34H50N2O6 and a molecular weight of 582.78 g/mol. Its IUPAC name is [(8S,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-1-yl] 3,5-dinitrobenzoate.
| Compound Name | [(8S,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-1-yl] 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 123158374 |
| Molecular Formula | C34H50N2O6 |
| Molecular Weight | 582.78 g/mol |
| Exact Mass | 582.37 |
| IUPAC Name | [(8S,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-1-yl] 3,5-dinitrobenzoate |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CCC4CCCC(OC(=O)c5cc([N+](=O)[O-])cc([N+](=O)[O-])c5)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C34H50N2O6/c1-21(2)8-6-9-22(3)28-14-15-29-27-13-12-24-10-7-11-31(34(24,5)30(27)16-17-33(28,29)4)42-32(37)23-18-25(35(38)39)20-26(19-23)36(40)41/h18-22,24,27-31H,6-17H2,1-5H3/t22-,24?,27+,28-,29+,30+,31?,33-,34+/m1/s1 |
| InChIKey | PBRHWCZPEMHNAP-HKODQLKYSA-N |
| XLogP | 9.15 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.78 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|