C30H50O2 — CID 141143266
[(5R,8R,9S,10S,13R,14S,17S)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-1-yl] prop-2-enoate (PubChem CID 141143266) has the molecular formula C30H50O2 and a molecular weight of 442.73 g/mol. Its IUPAC name is [(5R,8R,9S,10S,13R,14S,17S)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-1-yl] prop-2-enoate.
| Compound Name | [(5R,8R,9S,10S,13R,14S,17S)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-1-yl] prop-2-enoate |
|---|---|
| PubChem CID | 141143266 |
| Molecular Formula | C30H50O2 |
| Molecular Weight | 442.73 g/mol |
| Exact Mass | 442.38 |
| IUPAC Name | [(5R,8R,9S,10S,13R,14S,17S)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-1-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC1CCC[C@@H]2CC[C@@H]3[C@@H]4CC[C@@H]([C@@H](C)CCCC(C)C)[C@@]4(C)CC[C@@H]3[C@@]12C |
| InChI | InChI=1S/C30H50O2/c1-7-28(31)32-27-13-9-12-22-14-15-23-25-17-16-24(21(4)11-8-10-20(2)3)29(25,5)19-18-26(23)30(22,27)6/h7,20-27H,1,8-19H2,2-6H3/t21-,22+,23+,24-,25-,26-,27?,29+,30-/m0/s1 |
| InChIKey | OFYXZAWUIPCMKP-MSXLLMTOSA-N |
| XLogP | 8.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.73 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|