C46H38N6O6 — CID 70210567
3,4-bis[1-(3-hydroxypropyl)indol-3-yl]pyrrole-2,5-dione;3,4-bis(1H-indol-2-yl)pyrrole-2,5-dione (PubChem CID 70210567) has the molecular formula C46H38N6O6 and a molecular weight of 770.85 g/mol. Its IUPAC name is 3,4-bis[1-(3-hydroxypropyl)indol-3-yl]pyrrole-2,5-dione;3,4-bis(1H-indol-2-yl)pyrrole-2,5-dione.
| Compound Name | 3,4-bis[1-(3-hydroxypropyl)indol-3-yl]pyrrole-2,5-dione;3,4-bis(1H-indol-2-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 70210567 |
| Molecular Formula | C46H38N6O6 |
| Molecular Weight | 770.85 g/mol |
| Exact Mass | 770.29 |
| IUPAC Name | 3,4-bis[1-(3-hydroxypropyl)indol-3-yl]pyrrole-2,5-dione;3,4-bis(1H-indol-2-yl)pyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(c2cc3ccccc3[nH]2)=C1c1cc2ccccc2[nH]1.O=C1NC(=O)C(c2cn(CCCO)c3ccccc23)=C1c1cn(CCCO)c2ccccc12 |
| InChI | InChI=1S/C26H25N3O4.C20H13N3O2/c30-13-5-11-28-15-19(17-7-1-3-9-21(17)28)23-24(26(33)27-25(23)32)20-16-29(12-6-14-31)22-10-4-2-8-18(20)22;24-19-17(15-9-11-5-1-3-7-13(11)21-15)18(20(25)23-19)16-10-12-6-2-4-8-14(12)22-16/h1-4,7-10,15-16,30-31H,5-6,11-14H2,(H,27,32,33);1-10,21-22H,(H,23,24,25) |
| InChIKey | YFEMUENFKMMWDC-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 174.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.85 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|