C23H25ClO3S — CID 7021292
(2R)-2-[(4-chlorophenyl)methylsulfanyl]-4-(4-cyclohexylphenyl)-4-oxobutanoic acid (PubChem CID 7021292) has the molecular formula C23H25ClO3S and a molecular weight of 416.97 g/mol. Its IUPAC name is (2R)-2-[(4-chlorophenyl)methylsulfanyl]-4-(4-cyclohexylphenyl)-4-oxobutanoic acid.
| Compound Name | (2R)-2-[(4-chlorophenyl)methylsulfanyl]-4-(4-cyclohexylphenyl)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 7021292 |
| Molecular Formula | C23H25ClO3S |
| Molecular Weight | 416.97 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | (2R)-2-[(4-chlorophenyl)methylsulfanyl]-4-(4-cyclohexylphenyl)-4-oxobutanoic acid |
| SMILES | O=C(CC(SCc1ccc(Cl)cc1)C(=O)O)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C23H25ClO3S/c24-20-12-6-16(7-13-20)15-28-22(23(26)27)14-21(25)19-10-8-18(9-11-19)17-4-2-1-3-5-17/h6-13,17,22H,1-5,14-15H2,(H,26,27) |
| InChIKey | IPGMIUZSKCOUQC-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.97 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |