C19H18ClO4S- — CID 7104142
(2R)-2-[(4-chlorophenyl)methylsulfanyl]-4-(4-ethoxyphenyl)-4-oxobutanoate (PubChem CID 7104142) has the molecular formula C19H18ClO4S- and a molecular weight of 377.87 g/mol. Its IUPAC name is (2R)-2-[(4-chlorophenyl)methylsulfanyl]-4-(4-ethoxyphenyl)-4-oxobutanoate.
| Compound Name | (2R)-2-[(4-chlorophenyl)methylsulfanyl]-4-(4-ethoxyphenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 7104142 |
| Molecular Formula | C19H18ClO4S- |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | (2R)-2-[(4-chlorophenyl)methylsulfanyl]-4-(4-ethoxyphenyl)-4-oxobutanoate |
| SMILES | CCOc1ccc(C(=O)C[C@@H](SCc2ccc(Cl)cc2)C(=O)[O-])cc1 |
| InChI | InChI=1S/C19H19ClO4S/c1-2-24-16-9-5-14(6-10-16)17(21)11-18(19(22)23)25-12-13-3-7-15(20)8-4-13/h3-10,18H,2,11-12H2,1H3,(H,22,23)/p-1/t18-/m1/s1 |
| InChIKey | SIMRPLDHTYWVHW-GOSISDBHSA-M |
| XLogP | 3.36 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |