C17H22Cl2N2 — CID 70213286
1-(3,4-dichlorophenyl)ethanamine;1-(3-methylphenyl)ethanamine (PubChem CID 70213286) has the molecular formula C17H22Cl2N2 and a molecular weight of 325.28 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)ethanamine;1-(3-methylphenyl)ethanamine.
| Compound Name | 1-(3,4-dichlorophenyl)ethanamine;1-(3-methylphenyl)ethanamine |
|---|---|
| PubChem CID | 70213286 |
| Molecular Formula | C17H22Cl2N2 |
| Molecular Weight | 325.28 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 1-(3,4-dichlorophenyl)ethanamine;1-(3-methylphenyl)ethanamine |
| SMILES | CC(N)c1ccc(Cl)c(Cl)c1.Cc1cccc(C(C)N)c1 |
| InChI | InChI=1S/C9H13N.C8H9Cl2N/c1-7-4-3-5-9(6-7)8(2)10;1-5(11)6-2-3-7(9)8(10)4-6/h3-6,8H,10H2,1-2H3;2-5H,11H2,1H3 |
| InChIKey | NJIZURPZNDNMFL-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.28 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |