C27H31ClN4O8 — CID 70214666
[2-[benzoyl(methyl)amino]-1-[(tert-butylamino)-(4-chlorobenzoyl)carbamoyl]oxy-2-oxoethyl] 2-[acetyl(methyl)amino]acetate (PubChem CID 70214666) has the molecular formula C27H31ClN4O8 and a molecular weight of 575.02 g/mol. Its IUPAC name is [2-[benzoyl(methyl)amino]-1-[(tert-butylamino)-(4-chlorobenzoyl)carbamoyl]oxy-2-oxoethyl] 2-[acetyl(methyl)amino]acetate.
| Compound Name | [2-[benzoyl(methyl)amino]-1-[(tert-butylamino)-(4-chlorobenzoyl)carbamoyl]oxy-2-oxoethyl] 2-[acetyl(methyl)amino]acetate |
|---|---|
| PubChem CID | 70214666 |
| Molecular Formula | C27H31ClN4O8 |
| Molecular Weight | 575.02 g/mol |
| Exact Mass | 574.18 |
| IUPAC Name | [2-[benzoyl(methyl)amino]-1-[(tert-butylamino)-(4-chlorobenzoyl)carbamoyl]oxy-2-oxoethyl] 2-[acetyl(methyl)amino]acetate |
| SMILES | CC(=O)N(C)CC(=O)OC(OC(=O)N(NC(C)(C)C)C(=O)c1ccc(Cl)cc1)C(=O)N(C)C(=O)c1ccccc1 |
| InChI | InChI=1S/C27H31ClN4O8/c1-17(33)30(5)16-21(34)39-25(24(37)31(6)22(35)18-10-8-7-9-11-18)40-26(38)32(29-27(2,3)4)23(36)19-12-14-20(28)15-13-19/h7-15,25,29H,16H2,1-6H3 |
| InChIKey | VXWMLPNOJCSRQK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 142.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.02 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|