C6H7N4P — CID 70215568
1-phosphanylpyrazolo[3,4-b]pyridin-5-amine (PubChem CID 70215568) has the molecular formula C6H7N4P and a molecular weight of 166.12 g/mol. Its IUPAC name is 1-phosphanylpyrazolo[3,4-b]pyridin-5-amine.
| Compound Name | 1-phosphanylpyrazolo[3,4-b]pyridin-5-amine |
|---|---|
| PubChem CID | 70215568 |
| Molecular Formula | C6H7N4P |
| Molecular Weight | 166.12 g/mol |
| Exact Mass | 166.04 |
| IUPAC Name | 1-phosphanylpyrazolo[3,4-b]pyridin-5-amine |
| SMILES | Nc1cnc2c(cnn2P)c1 |
| InChI | InChI=1S/C6H7N4P/c7-5-1-4-2-9-10(11)6(4)8-3-5/h1-3H,7,11H2 |
| InChIKey | BAULFCZPIJWCNA-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.12 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|