About (1R,5R)-8-methyl-1,2-diphenyl-8-azabicyclo[3.2.1]octane
(1R,5R)-8-methyl-1,2-diphenyl-8-azabicyclo[3.2.1]octane (PubChem CID 70215581) has the molecular formula C20H23N
and a molecular weight of 277.41 g/mol. Its IUPAC name is (1R,5R)-8-methyl-1,2-diphenyl-8-azabicyclo[3.2.1]octane.
Molecular Properties
| Compound Name | (1R,5R)-8-methyl-1,2-diphenyl-8-azabicyclo[3.2.1]octane |
| PubChem CID | 70215581 |
| Molecular Formula | C20H23N |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | (1R,5R)-8-methyl-1,2-diphenyl-8-azabicyclo[3.2.1]octane |
| SMILES | CN1[C@@H]2CCC(c3ccccc3)[C@@]1(c1ccccc1)CC2 |
| InChI | InChI=1S/C20H23N/c1-21-18-12-13-19(16-8-4-2-5-9-16)20(21,15-14-18)17-10-6-3-7-11-17/h2-11,18-19H,12-15H2,1H3/t18-,19?,20+/m1/s1 |
| InChIKey | AECXVDIESAVLLF-ITIDOPETSA-N |
| XLogP | 4.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1R,5R)-8-methyl-1,2-diphenyl-8-azabicyclo[3.2.1]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,5R)-8-methyl-1,2-diphenyl-8-azabicyclo[3.2.1]octane?
The IUPAC name of (1R,5R)-8-methyl-1,2-diphenyl-8-azabicyclo[3.2.1]octane (CID 70215581) is (1R,5R)-8-methyl-1,2-diphenyl-8-azabicyclo[3.2.1]octane.
What is the SMILES notation for (1R,5R)-8-methyl-1,2-diphenyl-8-azabicyclo[3.2.1]octane?
The canonical SMILES for (1R,5R)-8-methyl-1,2-diphenyl-8-azabicyclo[3.2.1]octane is CN1[C@@H]2CCC(c3ccccc3)[C@@]1(c1ccccc1)CC2.
What is the InChIKey of (1R,5R)-8-methyl-1,2-diphenyl-8-azabicyclo[3.2.1]octane?
The InChIKey is AECXVDIESAVLLF-ITIDOPETSA-N. The full InChI is InChI=1S/C20H23N/c1-21-18-12-13-19(16-8-4-2-5-9-16)20(21,15-14-18)17-10-6-3-7-11-17/h2-11,18-19H,12-15H2,1H3/t18-,19?,20+/m1/s1.
What are the key properties of (1R,5R)-8-methyl-1,2-diphenyl-8-azabicyclo[3.2.1]octane?
(1R,5R)-8-methyl-1,2-diphenyl-8-azabicyclo[3.2.1]octane has a molecular weight of 277.41 g/mol, XLogP of 4.55, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,5R)-8-methyl-1,2-diphenyl-8-azabicyclo[3.2.1]octane is sourced from PubChem (CID 70215581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).