C20H23N — CID 70215581
(1R,5R)-8-methyl-1,2-diphenyl-8-azabicyclo[3.2.1]octane (PubChem CID 70215581) has the molecular formula C20H23N and a molecular weight of 277.41 g/mol. Its IUPAC name is (1R,5R)-8-methyl-1,2-diphenyl-8-azabicyclo[3.2.1]octane.
| Compound Name | (1R,5R)-8-methyl-1,2-diphenyl-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 70215581 |
| Molecular Formula | C20H23N |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | (1R,5R)-8-methyl-1,2-diphenyl-8-azabicyclo[3.2.1]octane |
| SMILES | CN1[C@@H]2CCC(c3ccccc3)[C@@]1(c1ccccc1)CC2 |
| InChI | InChI=1S/C20H23N/c1-21-18-12-13-19(16-8-4-2-5-9-16)20(21,15-14-18)17-10-6-3-7-11-17/h2-11,18-19H,12-15H2,1H3/t18-,19?,20+/m1/s1 |
| InChIKey | AECXVDIESAVLLF-ITIDOPETSA-N |
| XLogP | 4.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |