C17H18ClN5O — CID 70216929
N-[N'-[(4-aminophenyl)methyl]carbamimidoyl]-1H-indole-3-carboxamide;hydrochloride (PubChem CID 70216929) has the molecular formula C17H18ClN5O and a molecular weight of 343.82 g/mol. Its IUPAC name is N-[N'-[(4-aminophenyl)methyl]carbamimidoyl]-1H-indole-3-carboxamide;hydrochloride.
| Compound Name | N-[N'-[(4-aminophenyl)methyl]carbamimidoyl]-1H-indole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 70216929 |
| Molecular Formula | C17H18ClN5O |
| Molecular Weight | 343.82 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | N-[N'-[(4-aminophenyl)methyl]carbamimidoyl]-1H-indole-3-carboxamide;hydrochloride |
| SMILES | Cl.N/C(=N\Cc1ccc(N)cc1)NC(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C17H17N5O.ClH/c18-12-7-5-11(6-8-12)9-21-17(19)22-16(23)14-10-20-15-4-2-1-3-13(14)15;/h1-8,10,20H,9,18H2,(H3,19,21,22,23);1H |
| InChIKey | LXHYINUPNQUQEB-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 109.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.82 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|