C19H18Cl2N6O — CID 136638911
N-[N'-[(4-amino-3,5-dichlorophenyl)methyl]carbamimidoyl]-3-imino-3-(1H-indol-3-yl)propanamide (PubChem CID 136638911) has the molecular formula C19H18Cl2N6O and a molecular weight of 417.30 g/mol. Its IUPAC name is N-[N'-[(4-amino-3,5-dichlorophenyl)methyl]carbamimidoyl]-3-imino-3-(1H-indol-3-yl)propanamide.
| Compound Name | N-[N'-[(4-amino-3,5-dichlorophenyl)methyl]carbamimidoyl]-3-imino-3-(1H-indol-3-yl)propanamide |
|---|---|
| PubChem CID | 136638911 |
| Molecular Formula | C19H18Cl2N6O |
| Molecular Weight | 417.30 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | N-[N'-[(4-amino-3,5-dichlorophenyl)methyl]carbamimidoyl]-3-imino-3-(1H-indol-3-yl)propanamide |
| SMILES | [H]/N=C(\CC(=O)N/C(N)=N/Cc1cc(Cl)c(N)c(Cl)c1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H18Cl2N6O/c20-13-5-10(6-14(21)18(13)23)8-26-19(24)27-17(28)7-15(22)12-9-25-16-4-2-1-3-11(12)16/h1-6,9,22,25H,7-8,23H2,(H3,24,26,27,28)/b22-15+ |
| InChIKey | PLCXMVPQZZHRKX-PXLXIMEGSA-N |
| XLogP | 3.45 |
| TPSA | 133.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.30 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|