C32H42BrN3O4 — CID 70220560
tert-butyl N-[(2R)-1-(4-bromophenyl)-4-[3-[1-(3-methoxypropyl)indol-2-yl]piperidin-1-yl]-4-oxobutan-2-yl]carbamate (PubChem CID 70220560) has the molecular formula C32H42BrN3O4 and a molecular weight of 612.61 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-(4-bromophenyl)-4-[3-[1-(3-methoxypropyl)indol-2-yl]piperidin-1-yl]-4-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-(4-bromophenyl)-4-[3-[1-(3-methoxypropyl)indol-2-yl]piperidin-1-yl]-4-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 70220560 |
| Molecular Formula | C32H42BrN3O4 |
| Molecular Weight | 612.61 g/mol |
| Exact Mass | 611.24 |
| IUPAC Name | tert-butyl N-[(2R)-1-(4-bromophenyl)-4-[3-[1-(3-methoxypropyl)indol-2-yl]piperidin-1-yl]-4-oxobutan-2-yl]carbamate |
| SMILES | COCCCn1c(C2CCCN(C(=O)C[C@@H](Cc3ccc(Br)cc3)NC(=O)OC(C)(C)C)C2)cc2ccccc21 |
| InChI | InChI=1S/C32H42BrN3O4/c1-32(2,3)40-31(38)34-27(19-23-12-14-26(33)15-13-23)21-30(37)35-16-7-10-25(22-35)29-20-24-9-5-6-11-28(24)36(29)17-8-18-39-4/h5-6,9,11-15,20,25,27H,7-8,10,16-19,21-22H2,1-4H3,(H,34,38)/t25?,27-/m1/s1 |
| InChIKey | WNIZHECZNMBOBP-ZCJYOONXSA-N |
| XLogP | 6.67 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.61 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|