C28H29ClLiNO4S — CID 70225190
lithium (2S)-2-[[4-[2-(2-chlorophenyl)ethoxymethyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate (PubChem CID 70225190) has the molecular formula C28H29ClLiNO4S and a molecular weight of 518.00 g/mol. Its IUPAC name is lithium (2S)-2-[[4-[2-(2-chlorophenyl)ethoxymethyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | lithium (2S)-2-[[4-[2-(2-chlorophenyl)ethoxymethyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 70225190 |
| Molecular Formula | C28H29ClLiNO4S |
| Molecular Weight | 518.00 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | lithium (2S)-2-[[4-[2-(2-chlorophenyl)ethoxymethyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@H](NC(=O)c1ccc(COCCc2ccccc2Cl)cc1-c1ccccc1C)C(=O)[O-].[Li+] |
| InChI | InChI=1S/C28H30ClNO4S.Li/c1-19-7-3-5-9-22(19)24-17-20(18-34-15-13-21-8-4-6-10-25(21)29)11-12-23(24)27(31)30-26(28(32)33)14-16-35-2;/h3-12,17,26H,13-16,18H2,1-2H3,(H,30,31)(H,32,33);/q;+1/p-1/t26-;/m0./s1 |
| InChIKey | BBQLWVNPRSLZFG-SNYZSRNZSA-M |
| XLogP | 1.68 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.00 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|