C15H19NO4 — CID 70226520
ethyl 7-methyl-2,3,4a,5,10,10a-hexahydro-[1,4]dioxino[2,3-g]quinoline-8-carboxylate (PubChem CID 70226520) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is ethyl 7-methyl-2,3,4a,5,10,10a-hexahydro-[1,4]dioxino[2,3-g]quinoline-8-carboxylate.
| Compound Name | ethyl 7-methyl-2,3,4a,5,10,10a-hexahydro-[1,4]dioxino[2,3-g]quinoline-8-carboxylate |
|---|---|
| PubChem CID | 70226520 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | ethyl 7-methyl-2,3,4a,5,10,10a-hexahydro-[1,4]dioxino[2,3-g]quinoline-8-carboxylate |
| SMILES | CCOC(=O)c1cc2c(nc1C)CC1OCCOC1C2 |
| InChI | InChI=1S/C15H19NO4/c1-3-18-15(17)11-6-10-7-13-14(20-5-4-19-13)8-12(10)16-9(11)2/h6,13-14H,3-5,7-8H2,1-2H3 |
| InChIKey | HMKBXTXLIIOBOH-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |