C20H17N3S — CID 70226897
N-(3-naphthalen-1-ylprop-1-en-2-yl)-2-(1H-pyrazol-5-yl)thiophen-3-amine (PubChem CID 70226897) has the molecular formula C20H17N3S and a molecular weight of 331.44 g/mol. Its IUPAC name is N-(3-naphthalen-1-ylprop-1-en-2-yl)-2-(1H-pyrazol-5-yl)thiophen-3-amine.
| Compound Name | N-(3-naphthalen-1-ylprop-1-en-2-yl)-2-(1H-pyrazol-5-yl)thiophen-3-amine |
|---|---|
| PubChem CID | 70226897 |
| Molecular Formula | C20H17N3S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | N-(3-naphthalen-1-ylprop-1-en-2-yl)-2-(1H-pyrazol-5-yl)thiophen-3-amine |
| SMILES | C=C(Cc1cccc2ccccc12)Nc1ccsc1-c1ccn[nH]1 |
| InChI | InChI=1S/C20H17N3S/c1-14(13-16-7-4-6-15-5-2-3-8-17(15)16)22-18-10-12-24-20(18)19-9-11-21-23-19/h2-12,22H,1,13H2,(H,21,23) |
| InChIKey | ZSEFDZZPZFALBM-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |